C22H37O2PS2Sn — CID 173428384
(2,6-dioctylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane;tin(2+) dihydride (PubChem CID 173428384) has the molecular formula C22H37O2PS2Sn and a molecular weight of 547.36 g/mol. Its IUPAC name is (2,6-dioctylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane;tin(2+) dihydride.
| Compound Name | (2,6-dioctylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane;tin(2+) dihydride |
|---|---|
| PubChem CID | 173428384 |
| Molecular Formula | C22H37O2PS2Sn |
| Molecular Weight | 547.36 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | (2,6-dioctylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane;tin(2+) dihydride |
| SMILES | CCCCCCCCc1cccc(CCCCCCCC)c1OP([O-])(=S)[S-].[Sn+2] |
| InChI | InChI=1S/C22H39O2PS2.Sn/c1-3-5-7-9-11-13-16-20-18-15-19-21(22(20)24-25(23,26)27)17-14-12-10-8-6-4-2;/h15,18-19H,3-14,16-17H2,1-2H3,(H2,23,26,27);/q;+2/p-2 |
| InChIKey | IKIANTPDYASMKL-UHFFFAOYSA-L |
| XLogP | 6.62 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.36 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|