C22H44O6P2S2Zn — CID 173024798
1,2-dioctylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane);zinc (PubChem CID 173024798) has the molecular formula C22H44O6P2S2Zn and a molecular weight of 596.06 g/mol. Its IUPAC name is 1,2-dioctylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane);zinc.
| Compound Name | 1,2-dioctylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane);zinc |
|---|---|
| PubChem CID | 173024798 |
| Molecular Formula | C22H44O6P2S2Zn |
| Molecular Weight | 596.06 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | 1,2-dioctylbenzene;bis(trihydroxy(sulfanylidene)-λ5-phosphane);zinc |
| SMILES | CCCCCCCCc1ccccc1CCCCCCCC.OP(O)(O)=S.OP(O)(O)=S.[Zn] |
| InChI | InChI=1S/C22H38.2H3O3PS.Zn/c1-3-5-7-9-11-13-17-21-19-15-16-20-22(21)18-14-12-10-8-6-4-2;2*1-4(2,3)5;/h15-16,19-20H,3-14,17-18H2,1-2H3;2*(H3,1,2,3,5); |
| InChIKey | VHIXYNZSAOHGND-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.06 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|