C14H21O2PS2Zn — CID 70606516
zinc (2-octylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane (PubChem CID 70606516) has the molecular formula C14H21O2PS2Zn and a molecular weight of 381.82 g/mol. Its IUPAC name is zinc (2-octylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane.
| Compound Name | zinc (2-octylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane |
|---|---|
| PubChem CID | 70606516 |
| Molecular Formula | C14H21O2PS2Zn |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | zinc (2-octylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane |
| SMILES | CCCCCCCCc1ccccc1OP([O-])(=S)[S-].[Zn+2] |
| InChI | InChI=1S/C14H23O2PS2.Zn/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)16-17(15,18)19;/h8-9,11-12H,2-7,10H2,1H3,(H2,15,18,19);/q;+2/p-2 |
| InChIKey | KYYHVSDNFWKQTB-UHFFFAOYSA-L |
| XLogP | 4.10 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|