C14H21Cl2O3P — CID 172843838
(3,4-dichloro-2-octylphenyl) dihydrogen phosphite (PubChem CID 172843838) has the molecular formula C14H21Cl2O3P and a molecular weight of 339.20 g/mol. Its IUPAC name is (3,4-dichloro-2-octylphenyl) dihydrogen phosphite.
| Compound Name | (3,4-dichloro-2-octylphenyl) dihydrogen phosphite |
|---|---|
| PubChem CID | 172843838 |
| Molecular Formula | C14H21Cl2O3P |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (3,4-dichloro-2-octylphenyl) dihydrogen phosphite |
| SMILES | CCCCCCCCc1c(OP(O)O)ccc(Cl)c1Cl |
| InChI | InChI=1S/C14H21Cl2O3P/c1-2-3-4-5-6-7-8-11-13(19-20(17)18)10-9-12(15)14(11)16/h9-10,17-18H,2-8H2,1H3 |
| InChIKey | XDOBNSNYVYZUKN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|