C30H34O4 — CID 21217000
diethyl 5-hexyl-2,3-diphenylbenzene-1,4-dicarboxylate (PubChem CID 21217000) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is diethyl 5-hexyl-2,3-diphenylbenzene-1,4-dicarboxylate.
| Compound Name | diethyl 5-hexyl-2,3-diphenylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 21217000 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | diethyl 5-hexyl-2,3-diphenylbenzene-1,4-dicarboxylate |
| SMILES | CCCCCCc1cc(C(=O)OCC)c(-c2ccccc2)c(-c2ccccc2)c1C(=O)OCC |
| InChI | InChI=1S/C30H34O4/c1-4-7-8-11-20-24-21-25(29(31)33-5-2)26(22-16-12-9-13-17-22)27(23-18-14-10-15-19-23)28(24)30(32)34-6-3/h9-10,12-19,21H,4-8,11,20H2,1-3H3 |
| InChIKey | CGLGASDUYKWYCH-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|