C17H26O2 — CID 166059942
ethyl 2,5-dibutylbenzoate (PubChem CID 166059942) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is ethyl 2,5-dibutylbenzoate.
| Compound Name | ethyl 2,5-dibutylbenzoate |
|---|---|
| PubChem CID | 166059942 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | ethyl 2,5-dibutylbenzoate |
| SMILES | CCCCc1ccc(CCCC)c(C(=O)OCC)c1 |
| InChI | InChI=1S/C17H26O2/c1-4-7-9-14-11-12-15(10-8-5-2)16(13-14)17(18)19-6-3/h11-13H,4-10H2,1-3H3 |
| InChIKey | ZIYZOCWPFGWPPY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |