C18H26O — CID 174661217
(E)-1-(2,5-dibutylphenyl)but-2-en-1-one (PubChem CID 174661217) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (E)-1-(2,5-dibutylphenyl)but-2-en-1-one.
| Compound Name | (E)-1-(2,5-dibutylphenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 174661217 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (E)-1-(2,5-dibutylphenyl)but-2-en-1-one |
| SMILES | C/C=C/C(=O)c1cc(CCCC)ccc1CCCC |
| InChI | InChI=1S/C18H26O/c1-4-7-10-15-12-13-16(11-8-5-2)17(14-15)18(19)9-6-3/h6,9,12-14H,4-5,7-8,10-11H2,1-3H3/b9-6+ |
| InChIKey | OAXGTPSJTRNNGG-RMKNXTFCSA-N |
| XLogP | 5.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|