C15H20 — CID 144862255
1-butyl-2-[(3Z)-penta-1,3-dien-2-yl]benzene (PubChem CID 144862255) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-butyl-2-[(3Z)-penta-1,3-dien-2-yl]benzene.
| Compound Name | 1-butyl-2-[(3Z)-penta-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 144862255 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1-butyl-2-[(3Z)-penta-1,3-dien-2-yl]benzene |
| SMILES | C=C(/C=C\C)c1ccccc1CCCC |
| InChI | InChI=1S/C15H20/c1-4-6-10-14-11-7-8-12-15(14)13(3)9-5-2/h5,7-9,11-12H,3-4,6,10H2,1-2H3/b9-5- |
| InChIKey | PISBFTAJNIWKTN-UITAMQMPSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|