C30H34O5 — CID 155459208
[1-[5-hydroxy-2-methyl-6-(3-methylphenyl)-3-pentylphenoxy]-3-oxo-1-phenylbutyl] formate (PubChem CID 155459208) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is [1-[5-hydroxy-2-methyl-6-(3-methylphenyl)-3-pentylphenoxy]-3-oxo-1-phenylbutyl] formate.
| Compound Name | [1-[5-hydroxy-2-methyl-6-(3-methylphenyl)-3-pentylphenoxy]-3-oxo-1-phenylbutyl] formate |
|---|---|
| PubChem CID | 155459208 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [1-[5-hydroxy-2-methyl-6-(3-methylphenyl)-3-pentylphenoxy]-3-oxo-1-phenylbutyl] formate |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(OC(CC(C)=O)(OC=O)c2ccccc2)c1C |
| InChI | InChI=1S/C30H34O5/c1-5-6-8-13-24-18-27(33)28(25-14-11-12-21(2)17-25)29(23(24)4)35-30(34-20-31,19-22(3)32)26-15-9-7-10-16-26/h7,9-12,14-18,20,33H,5-6,8,13,19H2,1-4H3 |
| InChIKey | WVYCBTUIJWAZFH-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|