C24H31NO4 — CID 166514097
(1-methylcyclopropyl) N-[[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]methyl]carbamate (PubChem CID 166514097) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is (1-methylcyclopropyl) N-[[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]methyl]carbamate.
| Compound Name | (1-methylcyclopropyl) N-[[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 166514097 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | (1-methylcyclopropyl) N-[[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]methyl]carbamate |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(O)c1CNC(=O)OC1(C)CC1 |
| InChI | InChI=1S/C24H31NO4/c1-4-5-6-9-17-14-20(26)21(18-10-7-8-16(2)13-18)22(27)19(17)15-25-23(28)29-24(3)11-12-24/h7-8,10,13-14,26-27H,4-6,9,11-12,15H2,1-3H3,(H,25,28) |
| InChIKey | PLRGWWREEKOUGC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|