C24H29NO6S — CID 165175752
1-[2-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonylethyl]pyrrolidine-2,5-dione (PubChem CID 165175752) has the molecular formula C24H29NO6S and a molecular weight of 459.56 g/mol. Its IUPAC name is 1-[2-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonylethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonylethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 165175752 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 1-[2-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonylethyl]pyrrolidine-2,5-dione |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(O)c1S(=O)(=O)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C24H29NO6S/c1-3-4-5-8-18-15-19(26)22(17-9-6-7-16(2)14-17)23(29)24(18)32(30,31)13-12-25-20(27)10-11-21(25)28/h6-7,9,14-15,26,29H,3-5,8,10-13H2,1-2H3 |
| InChIKey | OFZIOHLIUBOBSQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|