C25H31NO5 — CID 156715959
methyl (2R)-1-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylbenzoyl]pyrrolidine-2-carboxylate (PubChem CID 156715959) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is methyl (2R)-1-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylbenzoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylbenzoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 156715959 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | methyl (2R)-1-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylbenzoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(O)c1C(=O)N1CCC[C@@H]1C(=O)OC |
| InChI | InChI=1S/C25H31NO5/c1-4-5-6-10-18-15-20(27)21(17-11-7-9-16(2)14-17)23(28)22(18)24(29)26-13-8-12-19(26)25(30)31-3/h7,9,11,14-15,19,27-28H,4-6,8,10,12-13H2,1-3H3/t19-/m1/s1 |
| InChIKey | YONGGRUOUFOJBU-LJQANCHMSA-N |
| XLogP | 4.58 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|