C23H29NO5S — CID 175870750
2-[2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylphenyl]sulfonylacetamide (PubChem CID 175870750) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is 2-[2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylphenyl]sulfonylacetamide.
| Compound Name | 2-[2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylphenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 175870750 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-[2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylphenyl]sulfonylacetamide |
| SMILES | C=C(C)c1ccc(C)cc1-c1c(O)cc(CCCCC)c(S(=O)(=O)CC(N)=O)c1O |
| InChI | InChI=1S/C23H29NO5S/c1-5-6-7-8-16-12-19(25)21(18-11-15(4)9-10-17(18)14(2)3)22(27)23(16)30(28,29)13-20(24)26/h9-12,25,27H,2,5-8,13H2,1,3-4H3,(H2,24,26) |
| InChIKey | VVMWOALBGSOJHE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|