C24H30O5S — CID 155575952
2-(5-methyl-2-prop-1-en-2-ylphenyl)-4-(oxetan-3-ylsulfonyl)-5-pentylbenzene-1,3-diol (PubChem CID 155575952) has the molecular formula C24H30O5S and a molecular weight of 430.57 g/mol. Its IUPAC name is 2-(5-methyl-2-prop-1-en-2-ylphenyl)-4-(oxetan-3-ylsulfonyl)-5-pentylbenzene-1,3-diol.
| Compound Name | 2-(5-methyl-2-prop-1-en-2-ylphenyl)-4-(oxetan-3-ylsulfonyl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 155575952 |
| Molecular Formula | C24H30O5S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-(5-methyl-2-prop-1-en-2-ylphenyl)-4-(oxetan-3-ylsulfonyl)-5-pentylbenzene-1,3-diol |
| SMILES | C=C(C)c1ccc(C)cc1-c1c(O)cc(CCCCC)c(S(=O)(=O)C2COC2)c1O |
| InChI | InChI=1S/C24H30O5S/c1-5-6-7-8-17-12-21(25)22(20-11-16(4)9-10-19(20)15(2)3)23(26)24(17)30(27,28)18-13-29-14-18/h9-12,18,25-26H,2,5-8,13-14H2,1,3-4H3 |
| InChIKey | VXZAWRQNVPQHIZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|