C30H32O5 — CID 155459084
7-hydroxy-8-(3-methylphenyl)-2-(4-methylphenyl)-2-(2-oxopropyl)-5-pentyl-1,3-benzodioxin-4-one (PubChem CID 155459084) has the molecular formula C30H32O5 and a molecular weight of 472.58 g/mol. Its IUPAC name is 7-hydroxy-8-(3-methylphenyl)-2-(4-methylphenyl)-2-(2-oxopropyl)-5-pentyl-1,3-benzodioxin-4-one.
| Compound Name | 7-hydroxy-8-(3-methylphenyl)-2-(4-methylphenyl)-2-(2-oxopropyl)-5-pentyl-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 155459084 |
| Molecular Formula | C30H32O5 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 7-hydroxy-8-(3-methylphenyl)-2-(4-methylphenyl)-2-(2-oxopropyl)-5-pentyl-1,3-benzodioxin-4-one |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c2c1C(=O)OC(CC(C)=O)(c1ccc(C)cc1)O2 |
| InChI | InChI=1S/C30H32O5/c1-5-6-7-10-23-17-25(32)26(22-11-8-9-20(3)16-22)28-27(23)29(33)35-30(34-28,18-21(4)31)24-14-12-19(2)13-15-24/h8-9,11-17,32H,5-7,10,18H2,1-4H3 |
| InChIKey | NFXXRGFEKWDHTM-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|