C28H36O5 — CID 155461471
ethyl [9-methyl-6-methylidene-3-(2-methyloctan-2-yl)benzo[c]chromen-1-yl]oxymethyl carbonate (PubChem CID 155461471) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is ethyl [9-methyl-6-methylidene-3-(2-methyloctan-2-yl)benzo[c]chromen-1-yl]oxymethyl carbonate.
| Compound Name | ethyl [9-methyl-6-methylidene-3-(2-methyloctan-2-yl)benzo[c]chromen-1-yl]oxymethyl carbonate |
|---|---|
| PubChem CID | 155461471 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | ethyl [9-methyl-6-methylidene-3-(2-methyloctan-2-yl)benzo[c]chromen-1-yl]oxymethyl carbonate |
| SMILES | C=C1Oc2cc(C(C)(C)CCCCCC)cc(OCOC(=O)OCC)c2-c2cc(C)ccc21 |
| InChI | InChI=1S/C28H36O5/c1-7-9-10-11-14-28(5,6)21-16-24(31-18-32-27(29)30-8-2)26-23-15-19(3)12-13-22(23)20(4)33-25(26)17-21/h12-13,15-17H,4,7-11,14,18H2,1-3,5-6H3 |
| InChIKey | FMQOFMCQZBNMAB-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|