C41H52O5P2 — CID 167674736
1-[benzyl(methoxy)phosphoryl]oxy-3-[benzyl(methyl)phosphoryl]oxy-5-(2-methyloctan-2-yl)-2-(5-methyl-2-prop-1-en-2-ylphenyl)benzene (PubChem CID 167674736) has the molecular formula C41H52O5P2 and a molecular weight of 686.81 g/mol. Its IUPAC name is 1-[benzyl(methoxy)phosphoryl]oxy-3-[benzyl(methyl)phosphoryl]oxy-5-(2-methyloctan-2-yl)-2-(5-methyl-2-prop-1-en-2-ylphenyl)benzene.
| Compound Name | 1-[benzyl(methoxy)phosphoryl]oxy-3-[benzyl(methyl)phosphoryl]oxy-5-(2-methyloctan-2-yl)-2-(5-methyl-2-prop-1-en-2-ylphenyl)benzene |
|---|---|
| PubChem CID | 167674736 |
| Molecular Formula | C41H52O5P2 |
| Molecular Weight | 686.81 g/mol |
| Exact Mass | 686.33 |
| IUPAC Name | 1-[benzyl(methoxy)phosphoryl]oxy-3-[benzyl(methyl)phosphoryl]oxy-5-(2-methyloctan-2-yl)-2-(5-methyl-2-prop-1-en-2-ylphenyl)benzene |
| SMILES | C=C(C)c1ccc(C)cc1-c1c(OP(C)(=O)Cc2ccccc2)cc(C(C)(C)CCCCCC)cc1OP(=O)(Cc1ccccc1)OC |
| InChI | InChI=1S/C41H52O5P2/c1-9-10-11-18-25-41(5,6)35-27-38(45-47(8,42)29-33-19-14-12-15-20-33)40(37-26-32(4)23-24-36(37)31(2)3)39(28-35)46-48(43,44-7)30-34-21-16-13-17-22-34/h12-17,19-24,26-28H,2,9-11,18,25,29-30H2,1,3-8H3 |
| InChIKey | UQJOPQHHGSKKDN-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.81 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|