C25H36O4 — CID 57434804
[3-acetyloxy-2-cyclohex-2-en-1-yl-5-(2-methyloctan-2-yl)phenyl] acetate (PubChem CID 57434804) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is [3-acetyloxy-2-cyclohex-2-en-1-yl-5-(2-methyloctan-2-yl)phenyl] acetate.
| Compound Name | [3-acetyloxy-2-cyclohex-2-en-1-yl-5-(2-methyloctan-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 57434804 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [3-acetyloxy-2-cyclohex-2-en-1-yl-5-(2-methyloctan-2-yl)phenyl] acetate |
| SMILES | CCCCCCC(C)(C)c1cc(OC(C)=O)c(C2C=CCCC2)c(OC(C)=O)c1 |
| InChI | InChI=1S/C25H36O4/c1-6-7-8-12-15-25(4,5)21-16-22(28-18(2)26)24(20-13-10-9-11-14-20)23(17-21)29-19(3)27/h10,13,16-17,20H,6-9,11-12,14-15H2,1-5H3 |
| InChIKey | JJQVOPKWOPOHIF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|