C22H35NO3 — CID 164538930
N-cyclohexyl-2,6-dihydroxy-4-(2-methyloctan-2-yl)benzamide (PubChem CID 164538930) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is N-cyclohexyl-2,6-dihydroxy-4-(2-methyloctan-2-yl)benzamide.
| Compound Name | N-cyclohexyl-2,6-dihydroxy-4-(2-methyloctan-2-yl)benzamide |
|---|---|
| PubChem CID | 164538930 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | N-cyclohexyl-2,6-dihydroxy-4-(2-methyloctan-2-yl)benzamide |
| SMILES | CCCCCCC(C)(C)c1cc(O)c(C(=O)NC2CCCCC2)c(O)c1 |
| InChI | InChI=1S/C22H35NO3/c1-4-5-6-10-13-22(2,3)16-14-18(24)20(19(25)15-16)21(26)23-17-11-8-7-9-12-17/h14-15,17,24-25H,4-13H2,1-3H3,(H,23,26) |
| InChIKey | MBIALCQAWHEZFJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|