C22H26FNO3 — CID 164538947
N-cyclohexyl-4-[2-(4-fluorophenyl)propan-2-yl]-2,6-dihydroxybenzamide (PubChem CID 164538947) has the molecular formula C22H26FNO3 and a molecular weight of 371.45 g/mol. Its IUPAC name is N-cyclohexyl-4-[2-(4-fluorophenyl)propan-2-yl]-2,6-dihydroxybenzamide.
| Compound Name | N-cyclohexyl-4-[2-(4-fluorophenyl)propan-2-yl]-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 164538947 |
| Molecular Formula | C22H26FNO3 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-cyclohexyl-4-[2-(4-fluorophenyl)propan-2-yl]-2,6-dihydroxybenzamide |
| SMILES | CC(C)(c1ccc(F)cc1)c1cc(O)c(C(=O)NC2CCCCC2)c(O)c1 |
| InChI | InChI=1S/C22H26FNO3/c1-22(2,14-8-10-16(23)11-9-14)15-12-18(25)20(19(26)13-15)21(27)24-17-6-4-3-5-7-17/h8-13,17,25-26H,3-7H2,1-2H3,(H,24,27) |
| InChIKey | FFYBNUBXRBSWRJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |