C13H16N2O6 — CID 5272628
N-cyclohexyl-2,4,6-trihydroxy-3-nitrobenzamide (PubChem CID 5272628) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is N-cyclohexyl-2,4,6-trihydroxy-3-nitrobenzamide.
| Compound Name | N-cyclohexyl-2,4,6-trihydroxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 5272628 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-cyclohexyl-2,4,6-trihydroxy-3-nitrobenzamide |
| SMILES | O=C(NC1CCCCC1)c1c(O)cc(O)c([N+](=O)[O-])c1O |
| InChI | InChI=1S/C13H16N2O6/c16-8-6-9(17)11(15(20)21)12(18)10(8)13(19)14-7-4-2-1-3-5-7/h6-7,16-18H,1-5H2,(H,14,19) |
| InChIKey | BNTKXJOGHLKDSJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|