C25H42O3 — CID 145231065
2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane (PubChem CID 145231065) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane.
| Compound Name | 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane |
|---|---|
| PubChem CID | 145231065 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane |
| SMILES | CCC.CCCCCCC(C)(C)c1cc(O)c(C2C=C(C)C(O)CC2)c(O)c1 |
| InChI | InChI=1S/C22H34O3.C3H8/c1-5-6-7-8-11-22(3,4)17-13-19(24)21(20(25)14-17)16-9-10-18(23)15(2)12-16;1-3-2/h12-14,16,18,23-25H,5-11H2,1-4H3;3H2,1-2H3 |
| InChIKey | MBUQZGKLDZWEOK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|