About 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane
2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane (PubChem CID 145231065) has the molecular formula C25H42O3
and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane.
Molecular Properties
| Compound Name | 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane |
| PubChem CID | 145231065 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane |
| SMILES | CCC.CCCCCCC(C)(C)c1cc(O)c(C2C=C(C)C(O)CC2)c(O)c1 |
| InChI | InChI=1S/C22H34O3.C3H8/c1-5-6-7-8-11-22(3,4)17-13-19(24)21(20(25)14-17)16-9-10-18(23)15(2)12-16;1-3-2/h12-14,16,18,23-25H,5-11H2,1-4H3;3H2,1-2H3 |
| InChIKey | MBUQZGKLDZWEOK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane?
The IUPAC name of 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane (CID 145231065) is 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane.
What is the SMILES notation for 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane?
The canonical SMILES for 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane is CCC.CCCCCCC(C)(C)c1cc(O)c(C2C=C(C)C(O)CC2)c(O)c1.
What is the InChIKey of 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane?
The InChIKey is MBUQZGKLDZWEOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34O3.C3H8/c1-5-6-7-8-11-22(3,4)17-13-19(24)21(20(25)14-17)16-9-10-18(23)15(2)12-16;1-3-2/h12-14,16,18,23-25H,5-11H2,1-4H3;3H2,1-2H3.
What are the key properties of 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane?
2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane has a molecular weight of 390.61 g/mol, XLogP of 6.95, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)benzene-1,3-diol;propane is sourced from PubChem (CID 145231065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).