C30H48O4 — CID 163217268
[(3R,6S)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-5,5,6-trimethylcyclohexen-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 163217268) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is [(3R,6S)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-5,5,6-trimethylcyclohexen-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(3R,6S)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-5,5,6-trimethylcyclohexen-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163217268 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | [(3R,6S)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-5,5,6-trimethylcyclohexen-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCCCCCC(C)(C)c1cc(O)c([C@H]2C=C(COC(=O)C(C)(C)C)[C@@H](C)C(C)(C)C2)c(O)c1 |
| InChI | InChI=1S/C30H48O4/c1-10-11-12-13-14-29(6,7)23-16-24(31)26(25(32)17-23)21-15-22(20(2)30(8,9)18-21)19-34-27(33)28(3,4)5/h15-17,20-21,31-32H,10-14,18-19H2,1-9H3/t20-,21+/m1/s1 |
| InChIKey | RJJMPAFGSOQPNC-RTWAWAEBSA-N |
| XLogP | 8.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|