C30H46O4 — CID 15614380
[(1R,4R,5R)-4-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 2,2-dimethylpropanoate (PubChem CID 15614380) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is [(1R,4R,5R)-4-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1R,4R,5R)-4-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15614380 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | [(1R,4R,5R)-4-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 2,2-dimethylpropanoate |
| SMILES | CCCCCCC(C)(C)c1cc(O)c([C@@H]2C=C(COC(=O)C(C)(C)C)[C@@H]3C[C@H]2C3(C)C)c(O)c1 |
| InChI | InChI=1S/C30H46O4/c1-9-10-11-12-13-29(5,6)20-15-24(31)26(25(32)16-20)21-14-19(18-34-27(33)28(2,3)4)22-17-23(21)30(22,7)8/h14-16,21-23,31-32H,9-13,17-18H2,1-8H3/t21-,22+,23-/m1/s1 |
| InChIKey | DUKKRYHQQFFRHX-XPWALMASSA-N |
| XLogP | 7.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|