C24H32O3 — CID 123327049
3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]tetracyclo[4.3.0.01,8.02,9]nonan-5-one (PubChem CID 123327049) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]tetracyclo[4.3.0.01,8.02,9]nonan-5-one.
| Compound Name | 3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]tetracyclo[4.3.0.01,8.02,9]nonan-5-one |
|---|---|
| PubChem CID | 123327049 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]tetracyclo[4.3.0.01,8.02,9]nonan-5-one |
| SMILES | CCCCCCC(C)(C)c1cc(O)c(C2CC(=O)C3CC4C5C2C345)c(O)c1 |
| InChI | InChI=1S/C24H32O3/c1-4-5-6-7-8-23(2,3)13-9-18(26)20(19(27)10-13)14-11-17(25)15-12-16-22-21(14)24(15,16)22/h9-10,14-16,21-22,26-27H,4-8,11-12H2,1-3H3 |
| InChIKey | JTNRXSZRXHUCKK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|