C32H40O9 — CID 91330382
4-[3-(3-carboxyprop-2-enoyloxy)-2-[(1S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-5-(2-methyloctan-2-yl)phenoxy]-4-oxobut-2-enoic acid (PubChem CID 91330382) has the molecular formula C32H40O9 and a molecular weight of 568.66 g/mol. Its IUPAC name is 4-[3-(3-carboxyprop-2-enoyloxy)-2-[(1S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-5-(2-methyloctan-2-yl)phenoxy]-4-oxobut-2-enoic acid.
| Compound Name | 4-[3-(3-carboxyprop-2-enoyloxy)-2-[(1S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-5-(2-methyloctan-2-yl)phenoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 91330382 |
| Molecular Formula | C32H40O9 |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 4-[3-(3-carboxyprop-2-enoyloxy)-2-[(1S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-5-(2-methyloctan-2-yl)phenoxy]-4-oxobut-2-enoic acid |
| SMILES | CCCCCCC(C)(C)c1cc(OC(=O)C=CC(=O)O)c(C2CC(=O)[C@H]3C[C@@H]2C3(C)C)c(OC(=O)C=CC(=O)O)c1 |
| InChI | InChI=1S/C32H40O9/c1-6-7-8-9-14-31(2,3)19-15-24(40-28(38)12-10-26(34)35)30(25(16-19)41-29(39)13-11-27(36)37)20-17-23(33)22-18-21(20)32(22,4)5/h10-13,15-16,20-22H,6-9,14,17-18H2,1-5H3,(H,34,35)(H,36,37)/t20?,21-,22+/m0/s1 |
| InChIKey | AMKTUPIZXBUPAF-JTGIGXABSA-N |
| XLogP | 5.75 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|