C25H34O2 — CID 10215681
5-(2-methyloct-7-yn-2-yl)-2-[(1R,2S,5S)-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-3-enyl]benzene-1,3-diol (PubChem CID 10215681) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 5-(2-methyloct-7-yn-2-yl)-2-[(1R,2S,5S)-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-3-enyl]benzene-1,3-diol.
| Compound Name | 5-(2-methyloct-7-yn-2-yl)-2-[(1R,2S,5S)-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-3-enyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 10215681 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 5-(2-methyloct-7-yn-2-yl)-2-[(1R,2S,5S)-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-3-enyl]benzene-1,3-diol |
| SMILES | C#CCCCCC(C)(C)c1cc(O)c([C@H]2C=C(C)[C@@H]3C[C@H]2C3(C)C)c(O)c1 |
| InChI | InChI=1S/C25H34O2/c1-7-8-9-10-11-24(3,4)17-13-21(26)23(22(27)14-17)18-12-16(2)19-15-20(18)25(19,5)6/h1,12-14,18-20,26-27H,8-11,15H2,2-6H3/t18-,19-,20+/m0/s1 |
| InChIKey | OITRUMFBVVONOL-SLFFLAALSA-N |
| XLogP | 6.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|