C32H48N2O3 — CID 176561119
N-[[(1S,4S,5S)-4-[4-(8-amino-2-methyloctan-2-yl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]pent-4-ynamide (PubChem CID 176561119) has the molecular formula C32H48N2O3 and a molecular weight of 508.75 g/mol. Its IUPAC name is N-[[(1S,4S,5S)-4-[4-(8-amino-2-methyloctan-2-yl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]pent-4-ynamide.
| Compound Name | N-[[(1S,4S,5S)-4-[4-(8-amino-2-methyloctan-2-yl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]pent-4-ynamide |
|---|---|
| PubChem CID | 176561119 |
| Molecular Formula | C32H48N2O3 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.37 |
| IUPAC Name | N-[[(1S,4S,5S)-4-[4-(8-amino-2-methyloctan-2-yl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]pent-4-ynamide |
| SMILES | C#CCCC(=O)NCC1=C[C@H](c2c(OC)cc(C(C)(C)CCCCCCN)cc2OC)[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C32H48N2O3/c1-8-9-14-29(35)34-21-22-17-24(26-20-25(22)32(26,4)5)30-27(36-6)18-23(19-28(30)37-7)31(2,3)15-12-10-11-13-16-33/h1,17-19,24-26H,9-16,20-21,33H2,2-7H3,(H,34,35)/t24-,25+,26-/m0/s1 |
| InChIKey | KVJXCEAZWCQLLA-NXCFDTQHSA-N |
| XLogP | 6.11 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|