C50H70F4NO9+ — CID 118620283
bis[7,7-difluoro-7-[4-[(1R,2S,5S)-4-(hydroxymethyl)-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl]heptoxy]-oxoazanium (PubChem CID 118620283) has the molecular formula C50H70F4NO9+ and a molecular weight of 905.10 g/mol. Its IUPAC name is bis[7,7-difluoro-7-[4-[(1R,2S,5S)-4-(hydroxymethyl)-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl]heptoxy]-oxoazanium.
| Compound Name | bis[7,7-difluoro-7-[4-[(1R,2S,5S)-4-(hydroxymethyl)-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl]heptoxy]-oxoazanium |
|---|---|
| PubChem CID | 118620283 |
| Molecular Formula | C50H70F4NO9+ |
| Molecular Weight | 905.10 g/mol |
| Exact Mass | 904.50 |
| IUPAC Name | bis[7,7-difluoro-7-[4-[(1R,2S,5S)-4-(hydroxymethyl)-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl]heptoxy]-oxoazanium |
| SMILES | COc1cc(C(F)(F)CCCCCCO[N+](=O)OCCCCCCC(F)(F)c2cc(OC)c([C@H]3C=C(CO)[C@H]4C[C@H]3C4(C)C)c(OC)c2)cc(OC)c1[C@H]1C=C(CO)[C@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C50H70F4NO9/c1-47(2)37-27-39(47)35(21-31(37)29-56)45-41(59-5)23-33(24-42(45)60-6)49(51,52)17-13-9-11-15-19-63-55(58)64-20-16-12-10-14-18-50(53,54)34-25-43(61-7)46(44(26-34)62-8)36-22-32(30-57)38-28-40(36)48(38,3)4/h21-26,35-40,56-57H,9-20,27-30H2,1-8H3/q+1/t35-,36-,37+,38+,39+,40+/m0/s1 |
| InChIKey | XGTHFYLSHAECPL-OYEZVYLDSA-N |
| XLogP | 11.50 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.10 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|