C26H37F2NO5 — CID 118620274
[(1S,4S,5S)-4-[4-(1,1-difluorooctyl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl nitrate (PubChem CID 118620274) has the molecular formula C26H37F2NO5 and a molecular weight of 481.58 g/mol. Its IUPAC name is [(1S,4S,5S)-4-[4-(1,1-difluorooctyl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl nitrate.
| Compound Name | [(1S,4S,5S)-4-[4-(1,1-difluorooctyl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl nitrate |
|---|---|
| PubChem CID | 118620274 |
| Molecular Formula | C26H37F2NO5 |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | [(1S,4S,5S)-4-[4-(1,1-difluorooctyl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl nitrate |
| SMILES | CCCCCCCC(F)(F)c1cc(OC)c([C@H]2C=C(CO[N+](=O)[O-])[C@H]3C[C@@H]2C3(C)C)c(OC)c1 |
| InChI | InChI=1S/C26H37F2NO5/c1-6-7-8-9-10-11-26(27,28)18-13-22(32-4)24(23(14-18)33-5)19-12-17(16-34-29(30)31)20-15-21(19)25(20,2)3/h12-14,19-21H,6-11,15-16H2,1-5H3/t19-,20+,21-/m0/s1 |
| InChIKey | ZIHGWQJUVHDVIL-HBMCJLEFSA-N |
| XLogP | 7.05 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|