C23H36O2 — CID 57434781
7,7-dimethyl-3-(2-methyloctan-2-yl)-6,8,9,9a-tetrahydro-5aH-dibenzofuran-1-ol (PubChem CID 57434781) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is 7,7-dimethyl-3-(2-methyloctan-2-yl)-6,8,9,9a-tetrahydro-5aH-dibenzofuran-1-ol.
| Compound Name | 7,7-dimethyl-3-(2-methyloctan-2-yl)-6,8,9,9a-tetrahydro-5aH-dibenzofuran-1-ol |
|---|---|
| PubChem CID | 57434781 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 7,7-dimethyl-3-(2-methyloctan-2-yl)-6,8,9,9a-tetrahydro-5aH-dibenzofuran-1-ol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC1CC(C)(C)CCC21 |
| InChI | InChI=1S/C23H36O2/c1-6-7-8-9-11-23(4,5)16-13-18(24)21-17-10-12-22(2,3)15-20(17)25-19(21)14-16/h13-14,17,20,24H,6-12,15H2,1-5H3 |
| InChIKey | GJHWFJYVNZFZHR-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|