C20H28O3 — CID 12000974
9-hydroxy-7-(2-methylheptan-2-yl)-2,3,4a,9b-tetrahydro-1H-dibenzofuran-4-one (PubChem CID 12000974) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 9-hydroxy-7-(2-methylheptan-2-yl)-2,3,4a,9b-tetrahydro-1H-dibenzofuran-4-one.
| Compound Name | 9-hydroxy-7-(2-methylheptan-2-yl)-2,3,4a,9b-tetrahydro-1H-dibenzofuran-4-one |
|---|---|
| PubChem CID | 12000974 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 9-hydroxy-7-(2-methylheptan-2-yl)-2,3,4a,9b-tetrahydro-1H-dibenzofuran-4-one |
| SMILES | CCCCCC(C)(C)c1cc(O)c2c(c1)OC1C(=O)CCCC21 |
| InChI | InChI=1S/C20H28O3/c1-4-5-6-10-20(2,3)13-11-16(22)18-14-8-7-9-15(21)19(14)23-17(18)12-13/h11-12,14,19,22H,4-10H2,1-3H3 |
| InChIKey | BSCGIUXXXIVTTM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|