C24H36O2 — CID 170610367
(6aR,10aR)-6,9-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol (PubChem CID 170610367) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is (6aR,10aR)-6,9-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-6,9-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 170610367 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | (6aR,10aR)-6,9-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)[C@@H]1CCC(C)=C[C@@H]21 |
| InChI | InChI=1S/C24H36O2/c1-6-7-8-9-12-24(4,5)18-14-21(25)23-20-13-16(2)10-11-19(20)17(3)26-22(23)15-18/h13-15,17,19-20,25H,6-12H2,1-5H3/t17?,19-,20+/m0/s1 |
| InChIKey | UOOIDLMCKOPMPD-ZYJPSCNZSA-N |
| XLogP | 6.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|