C20H29NO3 — CID 12000975
(6Z)-6-hydroxyimino-3-(2-methylheptan-2-yl)-7,8,9,9a-tetrahydro-5aH-dibenzofuran-1-ol (PubChem CID 12000975) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (6Z)-6-hydroxyimino-3-(2-methylheptan-2-yl)-7,8,9,9a-tetrahydro-5aH-dibenzofuran-1-ol.
| Compound Name | (6Z)-6-hydroxyimino-3-(2-methylheptan-2-yl)-7,8,9,9a-tetrahydro-5aH-dibenzofuran-1-ol |
|---|---|
| PubChem CID | 12000975 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (6Z)-6-hydroxyimino-3-(2-methylheptan-2-yl)-7,8,9,9a-tetrahydro-5aH-dibenzofuran-1-ol |
| SMILES | CCCCCC(C)(C)c1cc(O)c2c(c1)OC1/C(=N\O)CCCC21 |
| InChI | InChI=1S/C20H29NO3/c1-4-5-6-10-20(2,3)13-11-16(22)18-14-8-7-9-15(21-23)19(14)24-17(18)12-13/h11-12,14,19,22-23H,4-10H2,1-3H3/b21-15- |
| InChIKey | RODVDDICIGIRCN-QNGOZBTKSA-N |
| XLogP | 5.11 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|