C22H34O2 — CID 155118805
2-(6-ethyl-3-methylcyclohex-2-en-1-yl)-5-(2-methylhexan-2-yl)benzene-1,3-diol (PubChem CID 155118805) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is 2-(6-ethyl-3-methylcyclohex-2-en-1-yl)-5-(2-methylhexan-2-yl)benzene-1,3-diol.
| Compound Name | 2-(6-ethyl-3-methylcyclohex-2-en-1-yl)-5-(2-methylhexan-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 155118805 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 2-(6-ethyl-3-methylcyclohex-2-en-1-yl)-5-(2-methylhexan-2-yl)benzene-1,3-diol |
| SMILES | CCCCC(C)(C)c1cc(O)c(C2C=C(C)CCC2CC)c(O)c1 |
| InChI | InChI=1S/C22H34O2/c1-6-8-11-22(4,5)17-13-19(23)21(20(24)14-17)18-12-15(3)9-10-16(18)7-2/h12-14,16,18,23-24H,6-11H2,1-5H3 |
| InChIKey | ZHGLBEOUDVZTNR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|