C23H34O3 — CID 168846263
9-(hydroxymethyl)-6,6-dimethyl-3-(2-methylhexan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 168846263) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methylhexan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methylhexan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 168846263 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 9-(hydroxymethyl)-6,6-dimethyl-3-(2-methylhexan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)C1CCC(CO)=CC21 |
| InChI | InChI=1S/C23H34O3/c1-6-7-10-22(2,3)16-12-19(25)21-17-11-15(14-24)8-9-18(17)23(4,5)26-20(21)13-16/h11-13,17-18,24-25H,6-10,14H2,1-5H3 |
| InChIKey | PKYKMULXTLRJDW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|