C24H37FO2 — CID 146508229
3-ethoxy-2-[3-(fluoromethyl)cyclohex-2-en-1-yl]-5-(2-methyloctan-2-yl)phenol (PubChem CID 146508229) has the molecular formula C24H37FO2 and a molecular weight of 376.56 g/mol. Its IUPAC name is 3-ethoxy-2-[3-(fluoromethyl)cyclohex-2-en-1-yl]-5-(2-methyloctan-2-yl)phenol.
| Compound Name | 3-ethoxy-2-[3-(fluoromethyl)cyclohex-2-en-1-yl]-5-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 146508229 |
| Molecular Formula | C24H37FO2 |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 3-ethoxy-2-[3-(fluoromethyl)cyclohex-2-en-1-yl]-5-(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c(C2C=C(CF)CCC2)c(OCC)c1 |
| InChI | InChI=1S/C24H37FO2/c1-5-7-8-9-13-24(3,4)20-15-21(26)23(22(16-20)27-6-2)19-12-10-11-18(14-19)17-25/h14-16,19,26H,5-13,17H2,1-4H3 |
| InChIKey | AANUPMWFXXSTSO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|