C23H39NO2 — CID 155332977
2-[(1S)-3-(ethoxyamino)cyclohexyl]-5-(2-methyloctan-2-yl)phenol (PubChem CID 155332977) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is 2-[(1S)-3-(ethoxyamino)cyclohexyl]-5-(2-methyloctan-2-yl)phenol.
| Compound Name | 2-[(1S)-3-(ethoxyamino)cyclohexyl]-5-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 155332977 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | 2-[(1S)-3-(ethoxyamino)cyclohexyl]-5-(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1ccc([C@H]2CCCC(NOCC)C2)c(O)c1 |
| InChI | InChI=1S/C23H39NO2/c1-5-7-8-9-15-23(3,4)19-13-14-21(22(25)17-19)18-11-10-12-20(16-18)24-26-6-2/h13-14,17-18,20,24-25H,5-12,15-16H2,1-4H3/t18-,20?/m0/s1 |
| InChIKey | WVVJADJZGBIQIM-LROBGIAVSA-N |
| XLogP | 6.21 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|