C22H36O — CID 126594241
3-[2-methyl-4-(2-methyloctan-2-yl)phenyl]cyclohexan-1-ol (PubChem CID 126594241) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is 3-[2-methyl-4-(2-methyloctan-2-yl)phenyl]cyclohexan-1-ol.
| Compound Name | 3-[2-methyl-4-(2-methyloctan-2-yl)phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 126594241 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | 3-[2-methyl-4-(2-methyloctan-2-yl)phenyl]cyclohexan-1-ol |
| SMILES | CCCCCCC(C)(C)c1ccc(C2CCCC(O)C2)c(C)c1 |
| InChI | InChI=1S/C22H36O/c1-5-6-7-8-14-22(3,4)19-12-13-21(17(2)15-19)18-10-9-11-20(23)16-18/h12-13,15,18,20,23H,5-11,14,16H2,1-4H3 |
| InChIKey | FTCOHNBNPDMDAN-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|