C42H66NO7+ — CID 90376055
bis[7-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-7-methyloctoxy]-oxoazanium (PubChem CID 90376055) has the molecular formula C42H66NO7+ and a molecular weight of 696.99 g/mol. Its IUPAC name is bis[7-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-7-methyloctoxy]-oxoazanium.
| Compound Name | bis[7-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-7-methyloctoxy]-oxoazanium |
|---|---|
| PubChem CID | 90376055 |
| Molecular Formula | C42H66NO7+ |
| Molecular Weight | 696.99 g/mol |
| Exact Mass | 696.48 |
| IUPAC Name | bis[7-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-7-methyloctoxy]-oxoazanium |
| SMILES | CC(C)(CCCCCCO[N+](=O)OCCCCCCC(C)(C)c1ccc([C@H]2CCC[C@@H](O)C2)c(O)c1)c1ccc([C@H]2CCC[C@@H](O)C2)c(O)c1 |
| InChI | InChI=1S/C42H65NO7/c1-41(2,33-19-21-37(39(46)29-33)31-15-13-17-35(44)27-31)23-9-5-7-11-25-49-43(48)50-26-12-8-6-10-24-42(3,4)34-20-22-38(40(47)30-34)32-16-14-18-36(45)28-32/h19-22,29-32,35-36,44-45H,5-18,23-28H2,1-4H3,(H-,46,47)/p+1/t31-,32-,35+,36+/m0/s1 |
| InChIKey | BQHIUFZCIWZNCN-BSTNIHDZSA-O |
| XLogP | 9.93 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.99 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|