C27H40O3 — CID 70374826
[5-(2-methyloctan-2-yl)-2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl)phenyl] acetate (PubChem CID 70374826) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is [5-(2-methyloctan-2-yl)-2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl)phenyl] acetate.
| Compound Name | [5-(2-methyloctan-2-yl)-2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl)phenyl] acetate |
|---|---|
| PubChem CID | 70374826 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | [5-(2-methyloctan-2-yl)-2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl)phenyl] acetate |
| SMILES | CCCCCCC(C)(C)c1ccc(C2CC(=O)CC3CCCCC32)c(OC(C)=O)c1 |
| InChI | InChI=1S/C27H40O3/c1-5-6-7-10-15-27(3,4)21-13-14-24(26(17-21)30-19(2)28)25-18-22(29)16-20-11-8-9-12-23(20)25/h13-14,17,20,23,25H,5-12,15-16,18H2,1-4H3 |
| InChIKey | OUJVAATYDMWDAH-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|