C32H44O3 — CID 57134004
[2-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-5-(2-methyloctan-2-yl)phenyl] benzoate (PubChem CID 57134004) has the molecular formula C32H44O3 and a molecular weight of 476.70 g/mol. Its IUPAC name is [2-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-5-(2-methyloctan-2-yl)phenyl] benzoate.
| Compound Name | [2-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-5-(2-methyloctan-2-yl)phenyl] benzoate |
|---|---|
| PubChem CID | 57134004 |
| Molecular Formula | C32H44O3 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | [2-(3-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-5-(2-methyloctan-2-yl)phenyl] benzoate |
| SMILES | CCCCCCC(C)(C)c1ccc(C2CC(O)CC3CCCCC32)c(OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C32H44O3/c1-4-5-6-12-19-32(2,3)25-17-18-28(29-22-26(33)20-24-15-10-11-16-27(24)29)30(21-25)35-31(34)23-13-8-7-9-14-23/h7-9,13-14,17-18,21,24,26-27,29,33H,4-6,10-12,15-16,19-20,22H2,1-3H3 |
| InChIKey | NPQZNHLSOIXIDR-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|