C25H42O3 — CID 71046279
2-[(1R,2S)-5-(hydroxymethyl)-2-propan-2-ylcyclohexyl]-5-(2-methyloctan-2-yl)benzene-1,3-diol (PubChem CID 71046279) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-[(1R,2S)-5-(hydroxymethyl)-2-propan-2-ylcyclohexyl]-5-(2-methyloctan-2-yl)benzene-1,3-diol.
| Compound Name | 2-[(1R,2S)-5-(hydroxymethyl)-2-propan-2-ylcyclohexyl]-5-(2-methyloctan-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 71046279 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 2-[(1R,2S)-5-(hydroxymethyl)-2-propan-2-ylcyclohexyl]-5-(2-methyloctan-2-yl)benzene-1,3-diol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c([C@@H]2CC(CO)CC[C@H]2C(C)C)c(O)c1 |
| InChI | InChI=1S/C25H42O3/c1-6-7-8-9-12-25(4,5)19-14-22(27)24(23(28)15-19)21-13-18(16-26)10-11-20(21)17(2)3/h14-15,17-18,20-21,26-28H,6-13,16H2,1-5H3/t18?,20-,21+/m0/s1 |
| InChIKey | VOMAJJKZPOGCBL-QYAPWVIVSA-N |
| XLogP | 6.49 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|