C23H36O5 — CID 121291451
butyl 2-[3,5-dihydroxy-4-[(1R,2S,5R)-5-hydroxy-2-propan-2-ylcyclohexyl]phenyl]-2-methylpropanoate (PubChem CID 121291451) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is butyl 2-[3,5-dihydroxy-4-[(1R,2S,5R)-5-hydroxy-2-propan-2-ylcyclohexyl]phenyl]-2-methylpropanoate.
| Compound Name | butyl 2-[3,5-dihydroxy-4-[(1R,2S,5R)-5-hydroxy-2-propan-2-ylcyclohexyl]phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 121291451 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | butyl 2-[3,5-dihydroxy-4-[(1R,2S,5R)-5-hydroxy-2-propan-2-ylcyclohexyl]phenyl]-2-methylpropanoate |
| SMILES | CCCCOC(=O)C(C)(C)c1cc(O)c([C@@H]2C[C@H](O)CC[C@H]2C(C)C)c(O)c1 |
| InChI | InChI=1S/C23H36O5/c1-6-7-10-28-22(27)23(4,5)15-11-19(25)21(20(26)12-15)18-13-16(24)8-9-17(18)14(2)3/h11-12,14,16-18,24-26H,6-10,13H2,1-5H3/t16-,17+,18-/m1/s1 |
| InChIKey | OPCSAMQYBSMJGY-FGTMMUONSA-N |
| XLogP | 4.62 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|