C24H38O3S2 — CID 89329773
5-(2-hexyl-1,3-dithiolan-2-yl)-2-[(1R,2S,5R)-5-hydroxy-2-propan-2-ylcyclohexyl]benzene-1,3-diol (PubChem CID 89329773) has the molecular formula C24H38O3S2 and a molecular weight of 438.70 g/mol. Its IUPAC name is 5-(2-hexyl-1,3-dithiolan-2-yl)-2-[(1R,2S,5R)-5-hydroxy-2-propan-2-ylcyclohexyl]benzene-1,3-diol.
| Compound Name | 5-(2-hexyl-1,3-dithiolan-2-yl)-2-[(1R,2S,5R)-5-hydroxy-2-propan-2-ylcyclohexyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 89329773 |
| Molecular Formula | C24H38O3S2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 5-(2-hexyl-1,3-dithiolan-2-yl)-2-[(1R,2S,5R)-5-hydroxy-2-propan-2-ylcyclohexyl]benzene-1,3-diol |
| SMILES | CCCCCCC1(c2cc(O)c([C@@H]3C[C@H](O)CC[C@H]3C(C)C)c(O)c2)SCCS1 |
| InChI | InChI=1S/C24H38O3S2/c1-4-5-6-7-10-24(28-11-12-29-24)17-13-21(26)23(22(27)14-17)20-15-18(25)8-9-19(20)16(2)3/h13-14,16,18-20,25-27H,4-12,15H2,1-3H3/t18-,19+,20-/m1/s1 |
| InChIKey | FGXFHXXNYSJBFZ-HSALFYBXSA-N |
| XLogP | 6.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|