C24H38O3S2 — CID 142205335
5-(2-hexyl-1,3-dithiolan-2-yl)-2-(3-hydroxycyclohexyl)-3-propan-2-yloxyphenol (PubChem CID 142205335) has the molecular formula C24H38O3S2 and a molecular weight of 438.70 g/mol. Its IUPAC name is 5-(2-hexyl-1,3-dithiolan-2-yl)-2-(3-hydroxycyclohexyl)-3-propan-2-yloxyphenol.
| Compound Name | 5-(2-hexyl-1,3-dithiolan-2-yl)-2-(3-hydroxycyclohexyl)-3-propan-2-yloxyphenol |
|---|---|
| PubChem CID | 142205335 |
| Molecular Formula | C24H38O3S2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 5-(2-hexyl-1,3-dithiolan-2-yl)-2-(3-hydroxycyclohexyl)-3-propan-2-yloxyphenol |
| SMILES | CCCCCCC1(c2cc(O)c(C3CCCC(O)C3)c(OC(C)C)c2)SCCS1 |
| InChI | InChI=1S/C24H38O3S2/c1-4-5-6-7-11-24(28-12-13-29-24)19-15-21(26)23(22(16-19)27-17(2)3)18-9-8-10-20(25)14-18/h15-18,20,25-26H,4-14H2,1-3H3 |
| InChIKey | VAYCCGQNWPECHC-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|