C16H23BrS2 — CID 11187498
2-(4-bromophenyl)-2-heptyl-1,3-dithiolane (PubChem CID 11187498) has the molecular formula C16H23BrS2 and a molecular weight of 359.40 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-heptyl-1,3-dithiolane.
| Compound Name | 2-(4-bromophenyl)-2-heptyl-1,3-dithiolane |
|---|---|
| PubChem CID | 11187498 |
| Molecular Formula | C16H23BrS2 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-(4-bromophenyl)-2-heptyl-1,3-dithiolane |
| SMILES | CCCCCCCC1(c2ccc(Br)cc2)SCCS1 |
| InChI | InChI=1S/C16H23BrS2/c1-2-3-4-5-6-11-16(18-12-13-19-16)14-7-9-15(17)10-8-14/h7-10H,2-6,11-13H2,1H3 |
| InChIKey | KEVZZUTVFYNTGF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|