C15H21BrS2 — CID 10315549
2-(5-bromopentyl)-2-phenyl-1,3-dithiane (PubChem CID 10315549) has the molecular formula C15H21BrS2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-(5-bromopentyl)-2-phenyl-1,3-dithiane.
| Compound Name | 2-(5-bromopentyl)-2-phenyl-1,3-dithiane |
|---|---|
| PubChem CID | 10315549 |
| Molecular Formula | C15H21BrS2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-(5-bromopentyl)-2-phenyl-1,3-dithiane |
| SMILES | BrCCCCCC1(c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C15H21BrS2/c16-11-6-2-5-10-15(17-12-7-13-18-15)14-8-3-1-4-9-14/h1,3-4,8-9H,2,5-7,10-13H2 |
| InChIKey | FRUWMDXRAVWOMQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|