C14H21ClN2S2 — CID 10425931
[5-(2-butyl-1,3-dithian-2-yl)-2-chlorophenyl]hydrazine (PubChem CID 10425931) has the molecular formula C14H21ClN2S2 and a molecular weight of 316.92 g/mol. Its IUPAC name is [5-(2-butyl-1,3-dithian-2-yl)-2-chlorophenyl]hydrazine.
| Compound Name | [5-(2-butyl-1,3-dithian-2-yl)-2-chlorophenyl]hydrazine |
|---|---|
| PubChem CID | 10425931 |
| Molecular Formula | C14H21ClN2S2 |
| Molecular Weight | 316.92 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | [5-(2-butyl-1,3-dithian-2-yl)-2-chlorophenyl]hydrazine |
| SMILES | CCCCC1(c2ccc(Cl)c(NN)c2)SCCCS1 |
| InChI | InChI=1S/C14H21ClN2S2/c1-2-3-7-14(18-8-4-9-19-14)11-5-6-12(15)13(10-11)17-16/h5-6,10,17H,2-4,7-9,16H2,1H3 |
| InChIKey | VETGZGWKFOHAQS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|