C23H32O3S2 — CID 142205331
(1R,4R,5S)-4-[4-(2-hexyl-1,3-dithiolan-2-yl)-2,6-dihydroxyphenyl]-6-methylbicyclo[3.1.1]heptan-2-one (PubChem CID 142205331) has the molecular formula C23H32O3S2 and a molecular weight of 420.64 g/mol. Its IUPAC name is (1R,4R,5S)-4-[4-(2-hexyl-1,3-dithiolan-2-yl)-2,6-dihydroxyphenyl]-6-methylbicyclo[3.1.1]heptan-2-one.
| Compound Name | (1R,4R,5S)-4-[4-(2-hexyl-1,3-dithiolan-2-yl)-2,6-dihydroxyphenyl]-6-methylbicyclo[3.1.1]heptan-2-one |
|---|---|
| PubChem CID | 142205331 |
| Molecular Formula | C23H32O3S2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (1R,4R,5S)-4-[4-(2-hexyl-1,3-dithiolan-2-yl)-2,6-dihydroxyphenyl]-6-methylbicyclo[3.1.1]heptan-2-one |
| SMILES | CCCCCCC1(c2cc(O)c([C@@H]3CC(=O)[C@@H]4C[C@H]3C4C)c(O)c2)SCCS1 |
| InChI | InChI=1S/C23H32O3S2/c1-3-4-5-6-7-23(27-8-9-28-23)15-10-20(25)22(21(26)11-15)18-13-19(24)17-12-16(18)14(17)2/h10-11,14,16-18,25-26H,3-9,12-13H2,1-2H3/t14?,16-,17+,18+/m0/s1 |
| InChIKey | MJJLLNIVGKPNPW-FPGJRIRASA-N |
| XLogP | 6.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|